C25H10F9N — CID 162503001
10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-9H-acridine (PubChem CID 162503001) has the molecular formula C25H10F9N and a molecular weight of 495.34 g/mol. Its IUPAC name is 10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-9H-acridine.
| Compound Name | 10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-9H-acridine |
|---|---|
| PubChem CID | 162503001 |
| Molecular Formula | C25H10F9N |
| Molecular Weight | 495.34 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-9H-acridine |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(N3c4ccccc4Cc4ccccc43)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25H10F9N/c26-16-14(17(27)21(31)22(32)20(16)30)15-18(28)23(33)25(24(34)19(15)29)35-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)35/h1-8H,9H2 |
| InChIKey | WSGDGYXSNWHSFH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.34 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|