C33H27F5N2 — CID 155041876
10-[2,3,4,5-tetramethyl-6-(2,5,6,7,8-pentafluoro-3-methyl-1,8a-dihydroquinolin-4-yl)phenyl]-9H-acridine (PubChem CID 155041876) has the molecular formula C33H27F5N2 and a molecular weight of 546.58 g/mol. Its IUPAC name is 10-[2,3,4,5-tetramethyl-6-(2,5,6,7,8-pentafluoro-3-methyl-1,8a-dihydroquinolin-4-yl)phenyl]-9H-acridine.
| Compound Name | 10-[2,3,4,5-tetramethyl-6-(2,5,6,7,8-pentafluoro-3-methyl-1,8a-dihydroquinolin-4-yl)phenyl]-9H-acridine |
|---|---|
| PubChem CID | 155041876 |
| Molecular Formula | C33H27F5N2 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 10-[2,3,4,5-tetramethyl-6-(2,5,6,7,8-pentafluoro-3-methyl-1,8a-dihydroquinolin-4-yl)phenyl]-9H-acridine |
| SMILES | CC1=C(F)NC2C(F)=C(F)C(F)=C(F)C2=C1c1c(C)c(C)c(C)c(C)c1N1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C33H27F5N2/c1-15-16(2)18(4)32(40-22-12-8-6-10-20(22)14-21-11-7-9-13-23(21)40)25(17(15)3)24-19(5)33(38)39-31-26(24)27(34)28(35)29(36)30(31)37/h6-13,31,39H,14H2,1-5H3 |
| InChIKey | VNMIJLLSIFHUDU-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|