About 2,3-dimethyl-4H-pyrrolo[1,2-a]indole
2,3-dimethyl-4H-pyrrolo[1,2-a]indole (PubChem CID 102254631) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,3-dimethyl-4H-pyrrolo[1,2-a]indole.
Molecular Properties
| Compound Name | 2,3-dimethyl-4H-pyrrolo[1,2-a]indole |
| PubChem CID | 102254631 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2,3-dimethyl-4H-pyrrolo[1,2-a]indole |
| SMILES | Cc1cn2c(c1C)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H13N/c1-9-8-14-12-6-4-3-5-11(12)7-13(14)10(9)2/h3-6,8H,7H2,1-2H3 |
| InChIKey | FSNKTRGZGWFNLV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-4H-pyrrolo[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4H-pyrrolo[1,2-a]indole?
The IUPAC name of 2,3-dimethyl-4H-pyrrolo[1,2-a]indole (CID 102254631) is 2,3-dimethyl-4H-pyrrolo[1,2-a]indole.
What is the SMILES notation for 2,3-dimethyl-4H-pyrrolo[1,2-a]indole?
The canonical SMILES for 2,3-dimethyl-4H-pyrrolo[1,2-a]indole is Cc1cn2c(c1C)Cc1ccccc1-2.
What is the InChIKey of 2,3-dimethyl-4H-pyrrolo[1,2-a]indole?
The InChIKey is FSNKTRGZGWFNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c1-9-8-14-12-6-4-3-5-11(12)7-13(14)10(9)2/h3-6,8H,7H2,1-2H3.
What are the key properties of 2,3-dimethyl-4H-pyrrolo[1,2-a]indole?
2,3-dimethyl-4H-pyrrolo[1,2-a]indole has a molecular weight of 183.25 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4H-pyrrolo[1,2-a]indole is sourced from PubChem (CID 102254631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).