C17H17NO — CID 165040020
2-(3,4-dimethyl-9H-acridin-10-yl)acetaldehyde (PubChem CID 165040020) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(3,4-dimethyl-9H-acridin-10-yl)acetaldehyde.
| Compound Name | 2-(3,4-dimethyl-9H-acridin-10-yl)acetaldehyde |
|---|---|
| PubChem CID | 165040020 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(3,4-dimethyl-9H-acridin-10-yl)acetaldehyde |
| SMILES | Cc1ccc2c(c1C)N(CC=O)c1ccccc1C2 |
| InChI | InChI=1S/C17H17NO/c1-12-7-8-15-11-14-5-3-4-6-16(14)18(9-10-19)17(15)13(12)2/h3-8,10H,9,11H2,1-2H3 |
| InChIKey | TZRQJURDHCRECA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|