C12H11N — CID 102254626
3-methyl-4H-pyrrolo[1,2-a]indole (PubChem CID 102254626) has the molecular formula C12H11N and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-methyl-4H-pyrrolo[1,2-a]indole.
| Compound Name | 3-methyl-4H-pyrrolo[1,2-a]indole |
|---|---|
| PubChem CID | 102254626 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3-methyl-4H-pyrrolo[1,2-a]indole |
| SMILES | Cc1ccn2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C12H11N/c1-9-6-7-13-11-5-3-2-4-10(11)8-12(9)13/h2-7H,8H2,1H3 |
| InChIKey | UAHMQTWKJIOYIQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |