C49H26F9N — CID 162503025
9,9-bis(4-phenylphenyl)-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine (PubChem CID 162503025) has the molecular formula C49H26F9N and a molecular weight of 799.74 g/mol. Its IUPAC name is 9,9-bis(4-phenylphenyl)-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine.
| Compound Name | 9,9-bis(4-phenylphenyl)-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine |
|---|---|
| PubChem CID | 162503025 |
| Molecular Formula | C49H26F9N |
| Molecular Weight | 799.74 g/mol |
| Exact Mass | 799.19 |
| IUPAC Name | 9,9-bis(4-phenylphenyl)-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(N3c4ccccc4C(c4ccc(-c5ccccc5)cc4)(c4ccc(-c5ccccc5)cc4)c4ccccc43)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C49H26F9N/c50-39-37(40(51)44(55)45(56)43(39)54)38-41(52)46(57)48(47(58)42(38)53)59-35-17-9-7-15-33(35)49(34-16-8-10-18-36(34)59,31-23-19-29(20-24-31)27-11-3-1-4-12-27)32-25-21-30(22-26-32)28-13-5-2-6-14-28/h1-26H |
| InChIKey | DCCZMHAOWWCALP-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.74 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|