C70H36F10N6 — CID 135131131
10-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,6-di(carbazol-9-yl)phenyl]-9,9-diphenylacridine (PubChem CID 135131131) has the molecular formula C70H36F10N6 and a molecular weight of 1151.08 g/mol. Its IUPAC name is 10-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,6-di(carbazol-9-yl)phenyl]-9,9-diphenylacridine.
| Compound Name | 10-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,6-di(carbazol-9-yl)phenyl]-9,9-diphenylacridine |
|---|---|
| PubChem CID | 135131131 |
| Molecular Formula | C70H36F10N6 |
| Molecular Weight | 1151.08 g/mol |
| Exact Mass | 1150.28 |
| IUPAC Name | 10-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-2,6-di(carbazol-9-yl)phenyl]-9,9-diphenylacridine |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3cc(-n4c5ccccc5c5ccccc54)c(N4c5ccccc5C(c5ccccc5)(c5ccccc5)c5ccccc54)c(-n4c5ccccc5c5ccccc54)c3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C70H36F10N6/c71-56-54(57(72)61(76)64(79)60(56)75)68-81-67(82-69(83-68)55-58(73)62(77)65(80)63(78)59(55)74)37-35-52(84-46-29-13-7-23-40(46)41-24-8-14-30-47(41)84)66(53(36-37)85-48-31-15-9-25-42(48)43-26-10-16-32-49(43)85)86-50-33-17-11-27-44(50)70(38-19-3-1-4-20-38,39-21-5-2-6-22-39)45-28-12-18-34-51(45)86/h1-36H |
| InChIKey | VOEHSHULVNOVPT-UHFFFAOYSA-N |
| XLogP | 18.62 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.08 |
| LogP ≤ 5 | 18.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|