C54H34F10N2Si — CID 145010410
10-[2-(9,9-dimethylacridin-10-yl)-5,5-bis(2,3,4,5,6-pentafluorophenyl)benzo[b][1]benzosilol-8-yl]-9,9-dimethylacridine (PubChem CID 145010410) has the molecular formula C54H34F10N2Si and a molecular weight of 928.95 g/mol. Its IUPAC name is 10-[2-(9,9-dimethylacridin-10-yl)-5,5-bis(2,3,4,5,6-pentafluorophenyl)benzo[b][1]benzosilol-8-yl]-9,9-dimethylacridine.
| Compound Name | 10-[2-(9,9-dimethylacridin-10-yl)-5,5-bis(2,3,4,5,6-pentafluorophenyl)benzo[b][1]benzosilol-8-yl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 145010410 |
| Molecular Formula | C54H34F10N2Si |
| Molecular Weight | 928.95 g/mol |
| Exact Mass | 928.23 |
| IUPAC Name | 10-[2-(9,9-dimethylacridin-10-yl)-5,5-bis(2,3,4,5,6-pentafluorophenyl)benzo[b][1]benzosilol-8-yl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2ccc3c(c2)-c2cc(N4c5ccccc5C(C)(C)c5ccccc54)ccc2[Si]3(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C54H34F10N2Si/c1-53(2)31-13-5-9-17-35(31)65(36-18-10-6-14-32(36)53)27-21-23-39-29(25-27)30-26-28(66-37-19-11-7-15-33(37)54(3,4)34-16-8-12-20-38(34)66)22-24-40(30)67(39,51-47(61)43(57)41(55)44(58)48(51)62)52-49(63)45(59)42(56)46(60)50(52)64/h5-26H,1-4H3 |
| InChIKey | UIWHBIWLRMNZCF-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.95 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|