C25H31NOSeSi — CID 164816575
2-[2-(9,9-dimethylacridin-10-yl)-5-trimethylsilylselenophen-3-yl]propan-2-ol (PubChem CID 164816575) has the molecular formula C25H31NOSeSi and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[2-(9,9-dimethylacridin-10-yl)-5-trimethylsilylselenophen-3-yl]propan-2-ol.
| Compound Name | 2-[2-(9,9-dimethylacridin-10-yl)-5-trimethylsilylselenophen-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 164816575 |
| Molecular Formula | C25H31NOSeSi |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[2-(9,9-dimethylacridin-10-yl)-5-trimethylsilylselenophen-3-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cc([Si](C)(C)C)[se]c1N1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H31NOSeSi/c1-24(2)17-12-8-10-14-20(17)26(21-15-11-9-13-18(21)24)23-19(25(3,4)27)16-22(28-23)29(5,6)7/h8-16,27H,1-7H3 |
| InChIKey | OLMJMSQCYXKIEO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|