C33H29NO2Se — CID 171405674
5-[[4-(9,9-dimethylacridin-10-yl)-2,5-diethylphenyl]methylidene]cyclopenta[c]selenophene-4,6-dione (PubChem CID 171405674) has the molecular formula C33H29NO2Se and a molecular weight of 550.56 g/mol. Its IUPAC name is 5-[[4-(9,9-dimethylacridin-10-yl)-2,5-diethylphenyl]methylidene]cyclopenta[c]selenophene-4,6-dione.
| Compound Name | 5-[[4-(9,9-dimethylacridin-10-yl)-2,5-diethylphenyl]methylidene]cyclopenta[c]selenophene-4,6-dione |
|---|---|
| PubChem CID | 171405674 |
| Molecular Formula | C33H29NO2Se |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 5-[[4-(9,9-dimethylacridin-10-yl)-2,5-diethylphenyl]methylidene]cyclopenta[c]selenophene-4,6-dione |
| SMILES | CCc1cc(N2c3ccccc3C(C)(C)c3ccccc32)c(CC)cc1C=C1C(=O)c2c[se]cc2C1=O |
| InChI | InChI=1S/C33H29NO2Se/c1-5-20-17-30(21(6-2)15-22(20)16-23-31(35)24-18-37-19-25(24)32(23)36)34-28-13-9-7-11-26(28)33(3,4)27-12-8-10-14-29(27)34/h7-19H,5-6H2,1-4H3 |
| InChIKey | HJIGWCCOFVQTHQ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|