C37H27Cl2NO3 — CID 121355533
5,6-dichloro-2-[[7-(4-ethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]indene-1,3-dione (PubChem CID 121355533) has the molecular formula C37H27Cl2NO3 and a molecular weight of 604.53 g/mol. Its IUPAC name is 5,6-dichloro-2-[[7-(4-ethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]indene-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[7-(4-ethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 121355533 |
| Molecular Formula | C37H27Cl2NO3 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 5,6-dichloro-2-[[7-(4-ethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]indene-1,3-dione |
| SMILES | CCOc1ccc(N2c3ccccc3C(C)(C)c3c2ccc2cc(C=C4C(=O)c5cc(Cl)c(Cl)cc5C4=O)ccc32)cc1 |
| InChI | InChI=1S/C37H27Cl2NO3/c1-4-43-24-13-11-23(12-14-24)40-32-8-6-5-7-29(32)37(2,3)34-25-15-9-21(17-22(25)10-16-33(34)40)18-28-35(41)26-19-30(38)31(39)20-27(26)36(28)42/h5-20H,4H2,1-3H3 |
| InChIKey | CVQXTYVHSGRMDY-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|