C41H31NO4 — CID 121359872
2-[[7-(3,5-dimethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 121359872) has the molecular formula C41H31NO4 and a molecular weight of 601.70 g/mol. Its IUPAC name is 2-[[7-(3,5-dimethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[7-(3,5-dimethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 121359872 |
| Molecular Formula | C41H31NO4 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 2-[[7-(3,5-dimethoxyphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | COc1cc(OC)cc(N2c3ccccc3C(C)(C)c3c2ccc2cc(C=C4C(=O)c5cc6ccccc6cc5C4=O)ccc32)c1 |
| InChI | InChI=1S/C41H31NO4/c1-41(2)35-11-7-8-12-36(35)42(28-21-29(45-3)23-30(22-28)46-4)37-16-14-27-17-24(13-15-31(27)38(37)41)18-34-39(43)32-19-25-9-5-6-10-26(25)20-33(32)40(34)44/h5-23H,1-4H3 |
| InChIKey | XCOFOUNHIARGAF-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|