C43H35NO2 — CID 51348973
2-[[7-(4-tert-butylphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 51348973) has the molecular formula C43H35NO2 and a molecular weight of 597.76 g/mol. Its IUPAC name is 2-[[7-(4-tert-butylphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[7-(4-tert-butylphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 51348973 |
| Molecular Formula | C43H35NO2 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 2-[[7-(4-tert-butylphenyl)-12,12-dimethylbenzo[a]acridin-3-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC(C)(C)c1ccc(N2c3ccccc3C(C)(C)c3c2ccc2cc(C=C4C(=O)c5cc6ccccc6cc5C4=O)ccc32)cc1 |
| InChI | InChI=1S/C43H35NO2/c1-42(2,3)30-16-18-31(19-17-30)44-37-13-9-8-12-36(37)43(4,5)39-32-20-14-26(22-29(32)15-21-38(39)44)23-35-40(45)33-24-27-10-6-7-11-28(27)25-34(33)41(35)46/h6-25H,1-5H3 |
| InChIKey | MOXFPVWNOWKYJJ-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|