C40H29NO2S — CID 121355530
2-[(12,12-dimethyl-10-methylsulfanyl-7-phenylbenzo[a]acridin-3-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 121355530) has the molecular formula C40H29NO2S and a molecular weight of 587.74 g/mol. Its IUPAC name is 2-[(12,12-dimethyl-10-methylsulfanyl-7-phenylbenzo[a]acridin-3-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(12,12-dimethyl-10-methylsulfanyl-7-phenylbenzo[a]acridin-3-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 121355530 |
| Molecular Formula | C40H29NO2S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 2-[(12,12-dimethyl-10-methylsulfanyl-7-phenylbenzo[a]acridin-3-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CSc1ccc2c(c1)C(C)(C)c1c(ccc3cc(C=C4C(=O)c5cc6ccccc6cc5C4=O)ccc13)N2c1ccccc1 |
| InChI | InChI=1S/C40H29NO2S/c1-40(2)34-23-29(44-3)15-18-35(34)41(28-11-5-4-6-12-28)36-17-14-27-19-24(13-16-30(27)37(36)40)20-33-38(42)31-21-25-9-7-8-10-26(25)22-32(31)39(33)43/h4-23H,1-3H3 |
| InChIKey | GDJZEXRZZXOIGI-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|