C42H33FN2O — CID 163639473
(2Z)-2-[[10-(2-fluoropropan-2-yl)-12,12-dimethyl-7-phenylbenzo[a]acridin-3-yl]methylidene]-1-iminocyclopenta[b]naphthalen-3-one (PubChem CID 163639473) has the molecular formula C42H33FN2O and a molecular weight of 600.74 g/mol. Its IUPAC name is (2Z)-2-[[10-(2-fluoropropan-2-yl)-12,12-dimethyl-7-phenylbenzo[a]acridin-3-yl]methylidene]-1-iminocyclopenta[b]naphthalen-3-one.
| Compound Name | (2Z)-2-[[10-(2-fluoropropan-2-yl)-12,12-dimethyl-7-phenylbenzo[a]acridin-3-yl]methylidene]-1-iminocyclopenta[b]naphthalen-3-one |
|---|---|
| PubChem CID | 163639473 |
| Molecular Formula | C42H33FN2O |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | (2Z)-2-[[10-(2-fluoropropan-2-yl)-12,12-dimethyl-7-phenylbenzo[a]acridin-3-yl]methylidene]-1-iminocyclopenta[b]naphthalen-3-one |
| SMILES | [H]/N=C1C(=C/c2ccc3c4c(ccc3c2)N(c2ccccc2)c2ccc(C(C)(C)F)cc2C4(C)C)/C(=O)c2cc3ccccc3cc2/1 |
| InChI | InChI=1S/C42H33FN2O/c1-41(2)35-24-29(42(3,4)43)16-19-36(35)45(30-12-6-5-7-13-30)37-18-15-28-20-25(14-17-31(28)38(37)41)21-34-39(44)32-22-26-10-8-9-11-27(26)23-33(32)40(34)46/h5-24,44H,1-4H3/b34-21-,44-39+ |
| InChIKey | ICZLSHBSEQDHGL-FNFUKRQXSA-N |
| XLogP | 10.95 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|