C35H23F2NO3 — CID 138500744
2-[[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]furan-2-yl]methylidene]-5,6-difluoroindene-1,3-dione (PubChem CID 138500744) has the molecular formula C35H23F2NO3 and a molecular weight of 543.57 g/mol. Its IUPAC name is 2-[[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]furan-2-yl]methylidene]-5,6-difluoroindene-1,3-dione.
| Compound Name | 2-[[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]furan-2-yl]methylidene]-5,6-difluoroindene-1,3-dione |
|---|---|
| PubChem CID | 138500744 |
| Molecular Formula | C35H23F2NO3 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 2-[[4,4-dimethyl-6-(N-phenylanilino)indeno[1,2-b]furan-2-yl]methylidene]-5,6-difluoroindene-1,3-dione |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2oc(C=C3C(=O)c4cc(F)c(F)cc4C3=O)cc21 |
| InChI | InChI=1S/C35H23F2NO3/c1-35(2)28-15-22(38(20-9-5-3-6-10-20)21-11-7-4-8-12-21)13-14-24(28)34-29(35)17-23(41-34)16-27-32(39)25-18-30(36)31(37)19-26(25)33(27)40/h3-19H,1-2H3 |
| InChIKey | ZNFOWQUDNQRAEK-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|