C39H28N4O2 — CID 138500668
2-[(2Z)-2-[[6-(N-(2,6-dimethyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 138500668) has the molecular formula C39H28N4O2 and a molecular weight of 584.68 g/mol. Its IUPAC name is 2-[(2Z)-2-[[6-(N-(2,6-dimethyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[6-(N-(2,6-dimethyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500668 |
| Molecular Formula | C39H28N4O2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 2-[(2Z)-2-[[6-(N-(2,6-dimethyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | Cc1cc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cc(/C=C4\C(=O)c5ccccc5C4=C(C#N)C#N)oc2-3)cc(C)n1 |
| InChI | InChI=1S/C39H28N4O2/c1-23-16-28(17-24(2)42-23)43(26-10-6-5-7-11-26)27-14-15-32-34(18-27)39(3,4)35-20-29(45-38(32)35)19-33-36(25(21-40)22-41)30-12-8-9-13-31(30)37(33)44/h5-20H,1-4H3/b33-19- |
| InChIKey | AVTHHVFRIDCXPS-APTWKGOFSA-N |
| XLogP | 9.15 |
| TPSA | 93.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|