C25H15F2N4O2P3 — CID 170175359
2-[(2Z)-2-[[2-[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]-1-methylfuro[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 170175359) has the molecular formula C25H15F2N4O2P3 and a molecular weight of 534.34 g/mol. Its IUPAC name is 2-[(2Z)-2-[[2-[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]-1-methylfuro[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[2-[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]-1-methylfuro[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170175359 |
| Molecular Formula | C25H15F2N4O2P3 |
| Molecular Weight | 534.34 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 2-[(2Z)-2-[[2-[3,4-difluoro-2,5,6-tris(phosphanyl)phenyl]-1-methylfuro[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | Cn1c(-c2c(P)c(F)c(F)c(P)c2P)nc2oc(/C=C3\C(=O)c4ccccc4C3=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C25H15F2N4O2P3/c1-31-15-7-11(6-14-16(10(8-28)9-29)12-4-2-3-5-13(12)20(14)32)33-25(15)30-24(31)17-21(34)18(26)19(27)23(36)22(17)35/h2-7H,34-36H2,1H3/b14-6- |
| InChIKey | VUGLQEKDACVEBP-NSIKDUERSA-N |
| XLogP | 3.69 |
| TPSA | 95.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|