C23H10N2O3S — CID 170175034
2-[(2Z)-2-[[5-(furan-2-yl)thieno[3,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 170175034) has the molecular formula C23H10N2O3S and a molecular weight of 394.41 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-(furan-2-yl)thieno[3,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[5-(furan-2-yl)thieno[3,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170175034 |
| Molecular Formula | C23H10N2O3S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[(2Z)-2-[[5-(furan-2-yl)thieno[3,2-b]furan-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C/c2cc3sc(-c4ccco4)cc3o2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H10N2O3S/c24-11-13(12-25)22-15-4-1-2-5-16(15)23(26)17(22)8-14-9-20-19(28-14)10-21(29-20)18-6-3-7-27-18/h1-10H/b17-8- |
| InChIKey | UCDAXAMULVNACY-IUXPMGMMSA-N |
| XLogP | 5.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|