C27H17N3O3 — CID 170175196
2-[(2Z)-3-oxo-2-[[2-(2,4,6-trimethylphenyl)furo[2,3-d][1,3]oxazol-5-yl]methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 170175196) has the molecular formula C27H17N3O3 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[(2Z)-3-oxo-2-[[2-(2,4,6-trimethylphenyl)furo[2,3-d][1,3]oxazol-5-yl]methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-3-oxo-2-[[2-(2,4,6-trimethylphenyl)furo[2,3-d][1,3]oxazol-5-yl]methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170175196 |
| Molecular Formula | C27H17N3O3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[(2Z)-3-oxo-2-[[2-(2,4,6-trimethylphenyl)furo[2,3-d][1,3]oxazol-5-yl]methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | Cc1cc(C)c(-c2nc3oc(/C=C4\C(=O)c5ccccc5C4=C(C#N)C#N)cc3o2)c(C)c1 |
| InChI | InChI=1S/C27H17N3O3/c1-14-8-15(2)23(16(3)9-14)27-30-26-22(33-27)11-18(32-26)10-21-24(17(12-28)13-29)19-6-4-5-7-20(19)25(21)31/h4-11H,1-3H3/b21-10- |
| InChIKey | UGSIWVCQRXSMBK-FBHDLOMBSA-N |
| XLogP | 6.09 |
| TPSA | 103.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|