C31H18ClN5O — CID 170174325
2-[(2Z)-2-[[2-(4-chlorophenyl)-1-methyl-4-phenylpyrrolo[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 170174325) has the molecular formula C31H18ClN5O and a molecular weight of 511.97 g/mol. Its IUPAC name is 2-[(2Z)-2-[[2-(4-chlorophenyl)-1-methyl-4-phenylpyrrolo[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[2-(4-chlorophenyl)-1-methyl-4-phenylpyrrolo[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170174325 |
| Molecular Formula | C31H18ClN5O |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 2-[(2Z)-2-[[2-(4-chlorophenyl)-1-methyl-4-phenylpyrrolo[2,3-d]imidazol-5-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | Cn1c(-c2ccc(Cl)cc2)nc2c1cc(/C=C1\C(=O)c3ccccc3C1=C(C#N)C#N)n2-c1ccccc1 |
| InChI | InChI=1S/C31H18ClN5O/c1-36-27-16-23(15-26-28(20(17-33)18-34)24-9-5-6-10-25(24)29(26)38)37(22-7-3-2-4-8-22)31(27)35-30(36)19-11-13-21(32)14-12-19/h2-16H,1H3/b26-15- |
| InChIKey | GRWNGSVULRFRDS-YSMPRRRNSA-N |
| XLogP | 6.77 |
| TPSA | 87.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|