C42H38Cl2N2O2S — CID 138500656
5,6-dichloro-2-[[6-(N-(2,6-ditert-butyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 138500656) has the molecular formula C42H38Cl2N2O2S and a molecular weight of 705.75 g/mol. Its IUPAC name is 5,6-dichloro-2-[[6-(N-(2,6-ditert-butyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[6-(N-(2,6-ditert-butyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 138500656 |
| Molecular Formula | C42H38Cl2N2O2S |
| Molecular Weight | 705.75 g/mol |
| Exact Mass | 704.20 |
| IUPAC Name | 5,6-dichloro-2-[[6-(N-(2,6-ditert-butyl-4-pyridinyl)anilino)-4,4-dimethylindeno[1,2-b]thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC(C)(C)c1cc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cc(C=C4C(=O)c5cc(Cl)c(Cl)cc5C4=O)sc2-3)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C42H38Cl2N2O2S/c1-40(2,3)35-17-25(18-36(45-35)41(4,5)6)46(23-12-10-9-11-13-23)24-14-15-27-31(16-24)42(7,8)32-20-26(49-39(27)32)19-30-37(47)28-21-33(43)34(44)22-29(28)38(30)48/h9-22H,1-8H3 |
| InChIKey | AOYGSYJMWOIOJZ-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.75 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|