C33H23N3O2S — CID 138500664
(6E)-6-[[7,7-dimethyl-10-(N-phenylanilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[c]pyridine-5,7-dione (PubChem CID 138500664) has the molecular formula C33H23N3O2S and a molecular weight of 525.63 g/mol. Its IUPAC name is (6E)-6-[[7,7-dimethyl-10-(N-phenylanilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[c]pyridine-5,7-dione.
| Compound Name | (6E)-6-[[7,7-dimethyl-10-(N-phenylanilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[c]pyridine-5,7-dione |
|---|---|
| PubChem CID | 138500664 |
| Molecular Formula | C33H23N3O2S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | (6E)-6-[[7,7-dimethyl-10-(N-phenylanilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[c]pyridine-5,7-dione |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccccc3)cnc2-c2sc(/C=C3\C(=O)c4ccncc4C3=O)cc21 |
| InChI | InChI=1S/C33H23N3O2S/c1-33(2)27-15-22(36(20-9-5-3-6-10-20)21-11-7-4-8-12-21)18-35-29(27)32-28(33)17-23(39-32)16-25-30(37)24-13-14-34-19-26(24)31(25)38/h3-19H,1-2H3/b25-16+ |
| InChIKey | RHQUPJYQWKYWPN-PCLIKHOPSA-N |
| XLogP | 7.78 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|