C36H24O4S2 — CID 164981130
2-[[4-[(1,3-dioxoinden-2-ylidene)methyl]-7,7,10,10-tetramethyl-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]methylidene]indene-1,3-dione (PubChem CID 164981130) has the molecular formula C36H24O4S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 2-[[4-[(1,3-dioxoinden-2-ylidene)methyl]-7,7,10,10-tetramethyl-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-[(1,3-dioxoinden-2-ylidene)methyl]-7,7,10,10-tetramethyl-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 164981130 |
| Molecular Formula | C36H24O4S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | 2-[[4-[(1,3-dioxoinden-2-ylidene)methyl]-7,7,10,10-tetramethyl-3,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-11-yl]methylidene]indene-1,3-dione |
| SMILES | CC1(C)C(C=C2C(=O)c3ccccc3C2=O)=Cc2sc3c(c21)C(C)(C)c1cc(C=C2C(=O)c4ccccc4C2=O)sc1-3 |
| InChI | InChI=1S/C36H24O4S2/c1-35(2)17(13-23-29(37)19-9-5-6-10-20(19)30(23)38)14-26-27(35)28-34(42-26)33-25(36(28,3)4)16-18(41-33)15-24-31(39)21-11-7-8-12-22(21)32(24)40/h5-16H,1-4H3 |
| InChIKey | CZXUZHNMLAEKFG-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|