C34H22O4S2 — CID 164759280
2-[[10-[(1,3-dioxoinden-2-ylidene)methyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,1'-cyclohexane]-4-yl]methylidene]indene-1,3-dione (PubChem CID 164759280) has the molecular formula C34H22O4S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[[10-[(1,3-dioxoinden-2-ylidene)methyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,1'-cyclohexane]-4-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[10-[(1,3-dioxoinden-2-ylidene)methyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,1'-cyclohexane]-4-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 164759280 |
| Molecular Formula | C34H22O4S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | 2-[[10-[(1,3-dioxoinden-2-ylidene)methyl]spiro[3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,1'-cyclohexane]-4-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2sc(C=C4C(=O)c5ccccc5C4=O)cc2C32CCCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C34H22O4S2/c35-28-20-8-2-3-9-21(20)29(36)24(28)14-18-16-26-32(39-18)33-27(34(26)12-6-1-7-13-34)17-19(40-33)15-25-30(37)22-10-4-5-11-23(22)31(25)38/h2-5,8-11,14-17H,1,6-7,12-13H2 |
| InChIKey | XXAAFLVCJGWAPR-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|