C39H30N2O2S — CID 145410974
2-[[10-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)-7,7-dimethyl-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 145410974) has the molecular formula C39H30N2O2S and a molecular weight of 590.75 g/mol. Its IUPAC name is 2-[[10-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)-7,7-dimethyl-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[10-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)-7,7-dimethyl-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 145410974 |
| Molecular Formula | C39H30N2O2S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-[[10-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)-7,7-dimethyl-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | C=C/C(=C\C=C/C)N(c1ccccc1)c1cnc2c(c1)C(C)(C)c1cc(C=C3C(=O)c4cc5ccccc5cc4C3=O)sc1-2 |
| InChI | InChI=1S/C39H30N2O2S/c1-5-7-15-26(6-2)41(27-16-9-8-10-17-27)28-20-33-35(40-23-28)38-34(39(33,3)4)22-29(44-38)21-32-36(42)30-18-24-13-11-12-14-25(24)19-31(30)37(32)43/h5-23H,2H2,1,3-4H3/b7-5-,26-15+ |
| InChIKey | GOVGSXDTNPPWNI-RCBCUTGLSA-N |
| XLogP | 9.85 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|