C43H25N3O2S — CID 138528055
6-[[6'-(N-phenylanilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]cyclopenta[b]pyrazine-5,7-dione (PubChem CID 138528055) has the molecular formula C43H25N3O2S and a molecular weight of 647.76 g/mol. Its IUPAC name is 6-[[6'-(N-phenylanilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]cyclopenta[b]pyrazine-5,7-dione.
| Compound Name | 6-[[6'-(N-phenylanilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]cyclopenta[b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 138528055 |
| Molecular Formula | C43H25N3O2S |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.17 |
| IUPAC Name | 6-[[6'-(N-phenylanilino)spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2'-yl]methylidene]cyclopenta[b]pyrazine-5,7-dione |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2ccc(N(c4ccccc4)c4ccccc4)cc2C32c3ccccc3-c3ccccc32)C(=O)c2nccnc21 |
| InChI | InChI=1S/C43H25N3O2S/c47-40-33(41(48)39-38(40)44-21-22-45-39)24-29-25-37-42(49-29)32-20-19-28(46(26-11-3-1-4-12-26)27-13-5-2-6-14-27)23-36(32)43(37)34-17-9-7-15-30(34)31-16-8-10-18-35(31)43/h1-25H |
| InChIKey | ACYIUXVHFAHDLE-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|