C36H31Cl2NO2 — CID 154970647
5,6-dichloro-2-[[10-ethyl-9,9-dimethyl-7-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]indene-1,3-dione (PubChem CID 154970647) has the molecular formula C36H31Cl2NO2 and a molecular weight of 580.56 g/mol. Its IUPAC name is 5,6-dichloro-2-[[10-ethyl-9,9-dimethyl-7-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[10-ethyl-9,9-dimethyl-7-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 154970647 |
| Molecular Formula | C36H31Cl2NO2 |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 5,6-dichloro-2-[[10-ethyl-9,9-dimethyl-7-(2,4,6-trimethylphenyl)acridin-2-yl]methylidene]indene-1,3-dione |
| SMILES | CCN1c2ccc(C=C3C(=O)c4cc(Cl)c(Cl)cc4C3=O)cc2C(C)(C)c2cc(-c3c(C)cc(C)cc3C)ccc21 |
| InChI | InChI=1S/C36H31Cl2NO2/c1-7-39-31-10-8-22(14-26-34(40)24-17-29(37)30(38)18-25(24)35(26)41)15-27(31)36(5,6)28-16-23(9-11-32(28)39)33-20(3)12-19(2)13-21(33)4/h8-18H,7H2,1-6H3 |
| InChIKey | UCHNEZDBYORISC-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|