C15H12F2O — CID 172909442
2-(2,4-dimethylphenyl)-4,5-difluorobenzaldehyde (PubChem CID 172909442) has the molecular formula C15H12F2O and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-4,5-difluorobenzaldehyde.
| Compound Name | 2-(2,4-dimethylphenyl)-4,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 172909442 |
| Molecular Formula | C15H12F2O |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-4,5-difluorobenzaldehyde |
| SMILES | Cc1ccc(-c2cc(F)c(F)cc2C=O)c(C)c1 |
| InChI | InChI=1S/C15H12F2O/c1-9-3-4-12(10(2)5-9)13-7-15(17)14(16)6-11(13)8-18/h3-8H,1-2H3 |
| InChIKey | CRCISJKAOUKELI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|