C33H15NO4S4 — CID 164998146
2-[[14-[(1,3-dioxoinden-2-ylidene)methyl]-10-methyl-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaen-6-yl]methylidene]indene-1,3-dione (PubChem CID 164998146) has the molecular formula C33H15NO4S4 and a molecular weight of 617.75 g/mol. Its IUPAC name is 2-[[14-[(1,3-dioxoinden-2-ylidene)methyl]-10-methyl-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaen-6-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[14-[(1,3-dioxoinden-2-ylidene)methyl]-10-methyl-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaen-6-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 164998146 |
| Molecular Formula | C33H15NO4S4 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 616.99 |
| IUPAC Name | 2-[[14-[(1,3-dioxoinden-2-ylidene)methyl]-10-methyl-3,7,13,17-tetrathia-10-azapentacyclo[9.6.0.02,9.04,8.012,16]heptadeca-1(11),2(9),4(8),5,12(16),14-hexaen-6-yl]methylidene]indene-1,3-dione |
| SMILES | Cn1c2c3sc(C=C4C(=O)c5ccccc5C4=O)cc3sc2c2sc3cc(C=C4C(=O)c5ccccc5C4=O)sc3c21 |
| InChI | InChI=1S/C33H15NO4S4/c1-34-24-30-22(12-14(39-30)10-20-26(35)16-6-2-3-7-17(16)27(20)36)41-32(24)33-25(34)31-23(42-33)13-15(40-31)11-21-28(37)18-8-4-5-9-19(18)29(21)38/h2-13H,1H3 |
| InChIKey | YBUDALXIDLPCOI-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|