C20H14GeO2S2 — CID 159553455
2-[(7,7-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]indene-1,3-dione (PubChem CID 159553455) has the molecular formula C20H14GeO2S2 and a molecular weight of 423.07 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(7,7-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 159553455 |
| Molecular Formula | C20H14GeO2S2 |
| Molecular Weight | 423.07 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | 2-[(7,7-dimethyl-3,11-dithia-7-germatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]indene-1,3-dione |
| SMILES | C[Ge]1(C)c2ccsc2-c2sc(C=C3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C20H14GeO2S2/c1-21(2)15-7-8-24-19(15)20-16(21)10-11(25-20)9-14-17(22)12-5-3-4-6-13(12)18(14)23/h3-10H,1-2H3 |
| InChIKey | IBXYROVKLMHLSK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.07 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|