C22H10N2O2S3 — CID 176597174
6-[(10-phenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]cyclopenta[d]pyridazine-5,7-dione (PubChem CID 176597174) has the molecular formula C22H10N2O2S3 and a molecular weight of 430.54 g/mol. Its IUPAC name is 6-[(10-phenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]cyclopenta[d]pyridazine-5,7-dione.
| Compound Name | 6-[(10-phenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]cyclopenta[d]pyridazine-5,7-dione |
|---|---|
| PubChem CID | 176597174 |
| Molecular Formula | C22H10N2O2S3 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 6-[(10-phenyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)methylidene]cyclopenta[d]pyridazine-5,7-dione |
| SMILES | O=C1C(=Cc2cc3sc4cc(-c5ccccc5)sc4c3s2)C(=O)c2cnncc21 |
| InChI | InChI=1S/C22H10N2O2S3/c25-19-13(20(26)15-10-24-23-9-14(15)19)6-12-7-17-21(27-12)22-18(28-17)8-16(29-22)11-4-2-1-3-5-11/h1-10H |
| InChIKey | QZYJNEORBVCYAT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|