C20H10F2S3 — CID 138460263
4,10-bis(4-fluorophenyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 138460263) has the molecular formula C20H10F2S3 and a molecular weight of 384.50 g/mol. Its IUPAC name is 4,10-bis(4-fluorophenyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-bis(4-fluorophenyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 138460263 |
| Molecular Formula | C20H10F2S3 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 4,10-bis(4-fluorophenyl)-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | Fc1ccc(-c2cc3sc4cc(-c5ccc(F)cc5)sc4c3s2)cc1 |
| InChI | InChI=1S/C20H10F2S3/c21-13-5-1-11(2-6-13)15-9-17-19(24-15)20-18(23-17)10-16(25-20)12-3-7-14(22)8-4-12/h1-10H |
| InChIKey | OXBZQPCIEVQBJQ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |