C26H13N5O2 — CID 168735612
(2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile (PubChem CID 168735612) has the molecular formula C26H13N5O2 and a molecular weight of 427.42 g/mol. Its IUPAC name is (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile.
| Compound Name | (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 168735612 |
| Molecular Formula | C26H13N5O2 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C\c2nc3c(cc(-c4ccc([N+]#[C-])cc4)n3C)o2)\C(=O)c2ccccc2\1 |
| InChI | InChI=1S/C26H13N5O2/c1-28-16-10-8-15(9-11-16)21-13-22-26(31(21)3)30-23(33-22)12-19-24(20(14-27)29-2)17-6-4-5-7-18(17)25(19)32/h4-13H,3H3/b19-12-,24-20- |
| InChIKey | MAHJCLHSLQMUGH-HKOIETQCSA-N |
| XLogP | 5.82 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|