C34H19N7 — CID 168736188
2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 168736188) has the molecular formula C34H19N7 and a molecular weight of 525.58 g/mol. Its IUPAC name is 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 168736188 |
| Molecular Formula | C34H19N7 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[(2Z,3Z)-3-[cyano(isocyano)methylidene]-2-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C/c2nc3c(cc(-c4ccccc4)n3C)n2-c2ccccc2)\C(=C(C#N)C#N)c2ccccc2\1 |
| InChI | InChI=1S/C34H19N7/c1-38-28(21-37)33-26-16-10-9-15-25(26)32(23(19-35)20-36)27(33)17-31-39-34-30(41(31)24-13-7-4-8-14-24)18-29(40(34)2)22-11-5-3-6-12-22/h3-18H,2H3/b27-17-,33-28- |
| InChIKey | JGLXTWYVEBYCEL-CSUUDBONSA-N |
| XLogP | 7.08 |
| TPSA | 98.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|