C17H9N5O — CID 137092650
2-[(4Z)-4-[cyano(isocyano)methylidene]-2-(2,6-dimethyl-4-pyridinyl)-3-hydroxycyclobut-2-en-1-ylidene]propanedinitrile (PubChem CID 137092650) has the molecular formula C17H9N5O and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-[(4Z)-4-[cyano(isocyano)methylidene]-2-(2,6-dimethyl-4-pyridinyl)-3-hydroxycyclobut-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[(4Z)-4-[cyano(isocyano)methylidene]-2-(2,6-dimethyl-4-pyridinyl)-3-hydroxycyclobut-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 137092650 |
| Molecular Formula | C17H9N5O |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[(4Z)-4-[cyano(isocyano)methylidene]-2-(2,6-dimethyl-4-pyridinyl)-3-hydroxycyclobut-2-en-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C(O)=C(c2cc(C)nc(C)c2)C1=C(C#N)C#N |
| InChI | InChI=1S/C17H9N5O/c1-9-4-11(5-10(2)22-9)15-14(12(6-18)7-19)16(17(15)23)13(8-20)21-3/h4-5,23H,1-2H3/b16-13- |
| InChIKey | HKMYAOCKINEKPD-SSZFMOIBSA-N |
| XLogP | 3.02 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|