C27H13NO2S2 — CID 168735767
2-[[5-(2-phenylethynyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735767) has the molecular formula C27H13NO2S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[[5-(2-phenylethynyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-(2-phenylethynyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735767 |
| Molecular Formula | C27H13NO2S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-[[5-(2-phenylethynyl)thieno[2,3-d][1,3]thiazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(C#Cc4ccccc4)cc3s2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C27H13NO2S2/c29-25-20-12-17-8-4-5-9-18(17)13-21(20)26(30)22(25)15-24-28-27-23(32-24)14-19(31-27)11-10-16-6-2-1-3-7-16/h1-9,12-15H |
| InChIKey | DCVNQHQZOOFWDO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|