C45H30N6O4S2 — CID 167064320
CID 167064320 (PubChem CID 167064320) has the molecular formula C45H30N6O4S2 and a molecular weight of 782.91 g/mol.
| Compound Name | CID 167064320 |
|---|---|
| PubChem CID | 167064320 |
| Molecular Formula | C45H30N6O4S2 |
| Molecular Weight | 782.91 g/mol |
| Exact Mass | 782.18 |
| IUPAC Name | — |
| SMILES | Cc1cc(C#N)c(C#N)cc1C(=O)/C(C=O)=C\c1nc2c(s1)C1=C(c3sc(C=C4C(=O)c5cc(C#N)c(C#N)cc5C4=O)nc3C13CCCCC3)C21CCCCC1 |
| InChI | InChI=1S/C45H30N6O4S2/c1-23-12-24(18-46)25(19-47)13-29(23)37(53)28(22-52)16-33-50-42-40(56-33)35-36(44(42)8-4-2-5-9-44)41-43(45(35)10-6-3-7-11-45)51-34(57-41)17-32-38(54)30-14-26(20-48)27(21-49)15-31(30)39(32)55/h12-17,22H,2-11H2,1H3/b28-16- |
| InChIKey | WLIOYHSCQKDIGL-NTFVMDSBSA-N |
| XLogP | 8.66 |
| TPSA | 189.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.91 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|