C29H29N3 — CID 123469260
(2E,4E)-5-(9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl)-2-isocyano-3-phenylpenta-2,4-dienenitrile (PubChem CID 123469260) has the molecular formula C29H29N3 and a molecular weight of 419.57 g/mol. Its IUPAC name is (2E,4E)-5-(9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl)-2-isocyano-3-phenylpenta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl)-2-isocyano-3-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 123469260 |
| Molecular Formula | C29H29N3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (2E,4E)-5-(9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl)-2-isocyano-3-phenylpenta-2,4-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(\C=C\C1=C2N(CCCC)c3ccccc3C2(C)CCC1)c1ccccc1 |
| InChI | InChI=1S/C29H29N3/c1-4-5-20-32-27-16-10-9-15-25(27)29(2)19-11-14-23(28(29)32)17-18-24(26(21-30)31-3)22-12-7-6-8-13-22/h6-10,12-13,15-18H,4-5,11,14,19-20H2,1-2H3/b18-17+,26-24+ |
| InChIKey | DLNWSVWUSIXZLX-FAWJACLCSA-N |
| XLogP | 7.41 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|