C46H67ClN2O4 — CID 177403006
8-[(2E)-2-[(2E)-2-[3-[(E)-2-carboxy-2-cyanoethenyl]-2-chloro-5-ethylcyclohex-2-en-1-ylidene]ethylidene]-3,3-dioctylindol-1-yl]octanoic acid (PubChem CID 177403006) has the molecular formula C46H67ClN2O4 and a molecular weight of 747.50 g/mol. Its IUPAC name is 8-[(2E)-2-[(2E)-2-[3-[(E)-2-carboxy-2-cyanoethenyl]-2-chloro-5-ethylcyclohex-2-en-1-ylidene]ethylidene]-3,3-dioctylindol-1-yl]octanoic acid.
| Compound Name | 8-[(2E)-2-[(2E)-2-[3-[(E)-2-carboxy-2-cyanoethenyl]-2-chloro-5-ethylcyclohex-2-en-1-ylidene]ethylidene]-3,3-dioctylindol-1-yl]octanoic acid |
|---|---|
| PubChem CID | 177403006 |
| Molecular Formula | C46H67ClN2O4 |
| Molecular Weight | 747.50 g/mol |
| Exact Mass | 746.48 |
| IUPAC Name | 8-[(2E)-2-[(2E)-2-[3-[(E)-2-carboxy-2-cyanoethenyl]-2-chloro-5-ethylcyclohex-2-en-1-ylidene]ethylidene]-3,3-dioctylindol-1-yl]octanoic acid |
| SMILES | CCCCCCCCC1(CCCCCCCC)/C(=C\C=C2/CC(CC)CC(/C=C(\C#N)C(=O)O)=C2Cl)N(CCCCCCCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C46H67ClN2O4/c1-4-7-9-11-15-21-29-46(30-22-16-12-10-8-5-2)40-24-19-20-25-41(40)49(31-23-17-13-14-18-26-43(50)51)42(46)28-27-37-32-36(6-3)33-38(44(37)47)34-39(35-48)45(52)53/h19-20,24-25,27-28,34,36H,4-18,21-23,26,29-33H2,1-3H3,(H,50,51)(H,52,53)/b37-27+,39-34+,42-28+ |
| InChIKey | YYVQYTLFYQCMSU-UCCFQBAJSA-N |
| XLogP | 13.33 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.50 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|