C30H39ClN4O7S — CID 143637739
3-[(2-chloroacetyl)-[3-[(2E)-2-[(E)-4-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propyl]amino]propane-1-sulfonic acid (PubChem CID 143637739) has the molecular formula C30H39ClN4O7S and a molecular weight of 635.18 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)-[3-[(2E)-2-[(E)-4-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[(2-chloroacetyl)-[3-[(2E)-2-[(E)-4-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 143637739 |
| Molecular Formula | C30H39ClN4O7S |
| Molecular Weight | 635.18 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 3-[(2-chloroacetyl)-[3-[(2E)-2-[(E)-4-(1,3-diethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propyl]amino]propane-1-sulfonic acid |
| SMILES | CCN1C(=O)C(=C/C=C/C=C2/N(CCCN(CCCS(=O)(=O)O)C(=O)CCl)c3ccccc3C2(C)C)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C30H39ClN4O7S/c1-5-33-27(37)22(28(38)34(6-2)29(33)39)13-7-10-16-25-30(3,4)23-14-8-9-15-24(23)35(25)19-11-17-32(26(36)21-31)18-12-20-43(40,41)42/h7-10,13-16H,5-6,11-12,17-21H2,1-4H3,(H,40,41,42)/b10-7+,25-16+ |
| InChIKey | PPARIQOJCVEFGX-QQBFNENRSA-N |
| XLogP | 3.72 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|