C36H46N3O5S2+ — CID 160898591
2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]methyl-methylamino]acetic acid (PubChem CID 160898591) has the molecular formula C36H46N3O5S2+ and a molecular weight of 664.91 g/mol. Its IUPAC name is 2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 160898591 |
| Molecular Formula | C36H46N3O5S2+ |
| Molecular Weight | 664.91 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | 2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfopropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]methyl-methylamino]acetic acid |
| SMILES | CSC(=C\C=C\C1=[N+](C)c2ccc(CN(C)CC(=O)O)cc2C1(C)C)/C=C/C=C1/N(CCCS(=O)(=O)O)c2ccccc2C1(C)C |
| InChI | InChI=1S/C36H45N3O5S2/c1-35(2)28-15-8-9-16-31(28)39(21-12-22-46(42,43)44)33(35)18-11-14-27(45-7)13-10-17-32-36(3,4)29-23-26(19-20-30(29)38(32)6)24-37(5)25-34(40)41/h8-11,13-20,23H,12,21-22,24-25H2,1-7H3,(H-,40,41,42,43,44)/p+1 |
| InChIKey | SPEXOTRZHTZZDO-UHFFFAOYSA-O |
| XLogP | 6.53 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.91 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|