C35H44N3O2S3+ — CID 139313155
2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfanylpropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanyl-methylamino]acetic acid (PubChem CID 139313155) has the molecular formula C35H44N3O2S3+ and a molecular weight of 634.96 g/mol. Its IUPAC name is 2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfanylpropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanyl-methylamino]acetic acid.
| Compound Name | 2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfanylpropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 139313155 |
| Molecular Formula | C35H44N3O2S3+ |
| Molecular Weight | 634.96 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 2-[[2-[(1E,3Z,5E,7E)-7-[3,3-dimethyl-1-(3-sulfanylpropyl)indol-2-ylidene]-4-methylsulfanylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanyl-methylamino]acetic acid |
| SMILES | CSC(=C\C=C\C1=[N+](C)c2ccc(SN(C)CC(=O)O)cc2C1(C)C)/C=C/C=C1/N(CCCS)c2ccccc2C1(C)C |
| InChI | InChI=1S/C35H43N3O2S3/c1-34(2)27-15-8-9-16-30(27)38(21-12-22-41)32(34)18-11-14-25(42-7)13-10-17-31-35(3,4)28-23-26(19-20-29(28)37(31)6)43-36(5)24-33(39)40/h8-11,13-20,23H,12,21-22,24H2,1-7H3,(H-,39,40,41)/p+1 |
| InChIKey | GYOLYMHCRLBRKN-UHFFFAOYSA-O |
| XLogP | 8.08 |
| TPSA | 46.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.96 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|