C39H54N3O4S+ — CID 157236759
3-[2-[5-[1-butyl-5-[[4-hydroxypent-4-enyl(methyl)amino]methyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 157236759) has the molecular formula C39H54N3O4S+ and a molecular weight of 660.94 g/mol. Its IUPAC name is 3-[2-[5-[1-butyl-5-[[4-hydroxypent-4-enyl(methyl)amino]methyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[5-[1-butyl-5-[[4-hydroxypent-4-enyl(methyl)amino]methyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 157236759 |
| Molecular Formula | C39H54N3O4S+ |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.38 |
| IUPAC Name | 3-[2-[5-[1-butyl-5-[[4-hydroxypent-4-enyl(methyl)amino]methyl]-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | C=C(O)CCCN(C)Cc1ccc2c(c1)C(C)(C)C(=CC=CC=CC1=[N+](CCCS(=O)(=O)O)c3ccccc3C1(C)C)N2CCCC |
| InChI | InChI=1S/C39H53N3O4S/c1-8-9-25-41-35-23-22-31(29-40(7)24-15-17-30(2)43)28-33(35)39(5,6)37(41)21-12-10-11-20-36-38(3,4)32-18-13-14-19-34(32)42(36)26-16-27-47(44,45)46/h10-14,18-23,28H,2,8-9,15-17,24-27,29H2,1,3-7H3,(H-,43,44,45,46)/p+1 |
| InChIKey | JOKUGZTTYIGYDI-UHFFFAOYSA-O |
| XLogP | 8.22 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|