C32H34N4O2S2 — CID 154350755
1-[2-(diethylamino)ethyl]-5-[1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)propan-2-ylidene]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 154350755) has the molecular formula C32H34N4O2S2 and a molecular weight of 570.78 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-5-[1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)propan-2-ylidene]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-[2-(diethylamino)ethyl]-5-[1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)propan-2-ylidene]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 154350755 |
| Molecular Formula | C32H34N4O2S2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-5-[1-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)propan-2-ylidene]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=C(C)C=C2Sc3ccc4ccccc4c3N2CC)C(=O)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C32H34N4O2S2/c1-5-33(6-2)19-20-35-30(37)28(31(38)36(32(35)39)24-14-9-8-10-15-24)22(4)21-27-34(7-3)29-25-16-12-11-13-23(25)17-18-26(29)40-27/h8-18,21H,5-7,19-20H2,1-4H3 |
| InChIKey | RXQVGTWTIBKCEW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|