C16H21N3O2S — CID 154114925
1-[2-(diethylamino)ethyl]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 154114925) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 154114925 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN(CC)CCN1C(=O)CC(=O)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C16H21N3O2S/c1-3-17(4-2)10-11-18-14(20)12-15(21)19(16(18)22)13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | GVRWZVZFEGOASW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|