C19H19N2OS2+ — CID 6158698
2-[(2Z)-5-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol (PubChem CID 6158698) has the molecular formula C19H19N2OS2+ and a molecular weight of 355.51 g/mol. Its IUPAC name is 2-[(2Z)-5-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol.
| Compound Name | 2-[(2Z)-5-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 6158698 |
| Molecular Formula | C19H19N2OS2+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(2Z)-5-methyl-2-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]ethanol |
| SMILES | Cc1ccc2c(c1)N(CCO)/C(=C/c1sc3ccccc3[n+]1C)S2 |
| InChI | InChI=1S/C19H19N2OS2/c1-13-7-8-17-15(11-13)21(9-10-22)19(24-17)12-18-20(2)14-5-3-4-6-16(14)23-18/h3-8,11-12,22H,9-10H2,1-2H3/q+1 |
| InChIKey | WHNWRMWYOADNRR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|