C23H33N4S+3 — CID 2308384
2-[[2,6-dimethyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyridin-1-ium-4-yl]methylidene]-3-ethyl-1,3-benzothiazole (PubChem CID 2308384) has the molecular formula C23H33N4S+3 and a molecular weight of 397.61 g/mol. Its IUPAC name is 2-[[2,6-dimethyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyridin-1-ium-4-yl]methylidene]-3-ethyl-1,3-benzothiazole.
| Compound Name | 2-[[2,6-dimethyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyridin-1-ium-4-yl]methylidene]-3-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 2308384 |
| Molecular Formula | C23H33N4S+3 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[[2,6-dimethyl-1-(2-piperazine-1,4-diium-1-ylethyl)pyridin-1-ium-4-yl]methylidene]-3-ethyl-1,3-benzothiazole |
| SMILES | CCN1C(=Cc2cc(C)[n+](CC[NH+]3CC[NH2+]CC3)c(C)c2)Sc2ccccc21 |
| InChI | InChI=1S/C23H31N4S/c1-4-26-21-7-5-6-8-22(21)28-23(26)17-20-15-18(2)27(19(3)16-20)14-13-25-11-9-24-10-12-25/h5-8,15-17,24H,4,9-14H2,1-3H3/q+1/p+2 |
| InChIKey | FPPVQJFRTYJDKZ-UHFFFAOYSA-P |
| XLogP | 0.98 |
| TPSA | 28.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|