C23H18Cl2N4O4S2 — CID 134921520
[(E)-chloro-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]diazene perchlorate (PubChem CID 134921520) has the molecular formula C23H18Cl2N4O4S2 and a molecular weight of 549.46 g/mol. Its IUPAC name is [(E)-chloro-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]diazene perchlorate.
| Compound Name | [(E)-chloro-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]diazene perchlorate |
|---|---|
| PubChem CID | 134921520 |
| Molecular Formula | C23H18Cl2N4O4S2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | [(E)-chloro-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]diazene perchlorate |
| SMILES | CN1/C(=C(Cl)/N=N/c2ccc(-c3sc4ccccc4[n+]3C)cc2)Sc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H18ClN4S2.ClHO4/c1-27-17-7-3-5-9-19(17)29-22(27)15-11-13-16(14-12-15)25-26-21(24)23-28(2)18-8-4-6-10-20(18)30-23;2-1(3,4)5/h3-14H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | UDHYFDVUJADFOB-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 124.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|