C30H25ClN2O7S2 — CID 45155774
[2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate perchlorate (PubChem CID 45155774) has the molecular formula C30H25ClN2O7S2 and a molecular weight of 625.12 g/mol. Its IUPAC name is [2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate perchlorate.
| Compound Name | [2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate perchlorate |
|---|---|
| PubChem CID | 45155774 |
| Molecular Formula | C30H25ClN2O7S2 |
| Molecular Weight | 625.12 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | [2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate perchlorate |
| SMILES | CC(=O)Oc1ccccc1C(=O)C(/C=C/c1sc2ccccc2[n+]1C)=C/C=C1/Sc2ccccc2N1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C30H25N2O3S2.ClHO4/c1-20(33)35-25-13-7-4-10-22(25)30(34)21(16-18-28-31(2)23-11-5-8-14-26(23)36-28)17-19-29-32(3)24-12-6-9-15-27(24)37-29;2-1(3,4)5/h4-19H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QLURYOMPQDKQHR-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 142.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|